C12H23N — CID 130507756
4-(2-cyclopropylethyl)-2,6-dimethylpiperidine (PubChem CID 130507756) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-(2-cyclopropylethyl)-2,6-dimethylpiperidine.
| Compound Name | 4-(2-cyclopropylethyl)-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 130507756 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-(2-cyclopropylethyl)-2,6-dimethylpiperidine |
| SMILES | CC1CC(CCC2CC2)CC(C)N1 |
| InChI | InChI=1S/C12H23N/c1-9-7-12(8-10(2)13-9)6-5-11-3-4-11/h9-13H,3-8H2,1-2H3 |
| InChIKey | XGPRAJRRWQOLSG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |