C8H17NO — CID 172701028
2-[(3S,6R)-6-methylpiperidin-3-yl]ethanol (PubChem CID 172701028) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-[(3S,6R)-6-methylpiperidin-3-yl]ethanol.
| Compound Name | 2-[(3S,6R)-6-methylpiperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 172701028 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-[(3S,6R)-6-methylpiperidin-3-yl]ethanol |
| SMILES | C[C@@H]1CC[C@@H](CCO)CN1 |
| InChI | InChI=1S/C8H17NO/c1-7-2-3-8(4-5-10)6-9-7/h7-10H,2-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | CYUBEWGYSOITSZ-SFYZADRCSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |