C10H19NO2 — CID 155820793
methyl 3-[(3S,6R)-6-methylpiperidin-3-yl]propanoate (PubChem CID 155820793) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is methyl 3-[(3S,6R)-6-methylpiperidin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S,6R)-6-methylpiperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 155820793 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | methyl 3-[(3S,6R)-6-methylpiperidin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1CC[C@@H](C)NC1 |
| InChI | InChI=1S/C10H19NO2/c1-8-3-4-9(7-11-8)5-6-10(12)13-2/h8-9,11H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | PVZASVULAWRPFT-BDAKNGLRSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |