About 5-methylpiperazin-2-ol;hydrochloride
5-methylpiperazin-2-ol;hydrochloride (PubChem CID 174721489) has the molecular formula C5H13ClN2O
and a molecular weight of 152.62 g/mol. Its IUPAC name is 5-methylpiperazin-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 5-methylpiperazin-2-ol;hydrochloride |
| PubChem CID | 174721489 |
| Molecular Formula | C5H13ClN2O |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 5-methylpiperazin-2-ol;hydrochloride |
| SMILES | CC1CNC(O)CN1.Cl |
| InChI | InChI=1S/C5H12N2O.ClH/c1-4-2-7-5(8)3-6-4;/h4-8H,2-3H2,1H3;1H |
| InChIKey | CTHWLLVUCFZFBZ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylpiperazin-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpiperazin-2-ol;hydrochloride?
The IUPAC name of 5-methylpiperazin-2-ol;hydrochloride (CID 174721489) is 5-methylpiperazin-2-ol;hydrochloride.
What is the SMILES notation for 5-methylpiperazin-2-ol;hydrochloride?
The canonical SMILES for 5-methylpiperazin-2-ol;hydrochloride is CC1CNC(O)CN1.Cl.
What is the InChIKey of 5-methylpiperazin-2-ol;hydrochloride?
The InChIKey is CTHWLLVUCFZFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.ClH/c1-4-2-7-5(8)3-6-4;/h4-8H,2-3H2,1H3;1H.
What are the key properties of 5-methylpiperazin-2-ol;hydrochloride?
5-methylpiperazin-2-ol;hydrochloride has a molecular weight of 152.62 g/mol, XLogP of -0.69, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpiperazin-2-ol;hydrochloride is sourced from PubChem (CID 174721489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).