C8H14N2S — CID 166890516
3-[(2S,5S)-5-methylpiperazin-2-yl]prop-2-yne-1-thiol (PubChem CID 166890516) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 3-[(2S,5S)-5-methylpiperazin-2-yl]prop-2-yne-1-thiol.
| Compound Name | 3-[(2S,5S)-5-methylpiperazin-2-yl]prop-2-yne-1-thiol |
|---|---|
| PubChem CID | 166890516 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-[(2S,5S)-5-methylpiperazin-2-yl]prop-2-yne-1-thiol |
| SMILES | C[C@H]1CN[C@@H](C#CCS)CN1 |
| InChI | InChI=1S/C8H14N2S/c1-7-5-10-8(6-9-7)3-2-4-11/h7-11H,4-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | LGZLFEVUSCAQTN-YUMQZZPRSA-N |
| XLogP | -0.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|