C11H23N3O — CID 70839277
2-methyl-1,5,9-triazacyclotridecan-4-one (PubChem CID 70839277) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-methyl-1,5,9-triazacyclotridecan-4-one.
| Compound Name | 2-methyl-1,5,9-triazacyclotridecan-4-one |
|---|---|
| PubChem CID | 70839277 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-methyl-1,5,9-triazacyclotridecan-4-one |
| SMILES | CC1CC(=O)NCCCNCCCCN1 |
| InChI | InChI=1S/C11H23N3O/c1-10-9-11(15)14-8-4-6-12-5-2-3-7-13-10/h10,12-13H,2-9H2,1H3,(H,14,15) |
| InChIKey | XUOLXSMFVWSGDI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |