C10H19N3O2 — CID 66730143
3-methyl-1,5,9-triazacyclododecane-2,4-dione (PubChem CID 66730143) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-methyl-1,5,9-triazacyclododecane-2,4-dione.
| Compound Name | 3-methyl-1,5,9-triazacyclododecane-2,4-dione |
|---|---|
| PubChem CID | 66730143 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-methyl-1,5,9-triazacyclododecane-2,4-dione |
| SMILES | CC1C(=O)NCCCNCCCNC1=O |
| InChI | InChI=1S/C10H19N3O2/c1-8-9(14)12-6-2-4-11-5-3-7-13-10(8)15/h8,11H,2-7H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | VCPKROVWLXLARL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|