C11H21N3O — CID 78228721
2-(azepan-1-yl)-6-methyl-1,3-diazinan-4-one (PubChem CID 78228721) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-(azepan-1-yl)-6-methyl-1,3-diazinan-4-one.
| Compound Name | 2-(azepan-1-yl)-6-methyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78228721 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-(azepan-1-yl)-6-methyl-1,3-diazinan-4-one |
| SMILES | CC1CC(=O)NC(N2CCCCCC2)N1 |
| InChI | InChI=1S/C11H21N3O/c1-9-8-10(15)13-11(12-9)14-6-4-2-3-5-7-14/h9,11-12H,2-8H2,1H3,(H,13,15) |
| InChIKey | LGBLDCVGVNERDX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |