About 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one
2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one (PubChem CID 15618513) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one.
Analyze 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one?
The IUPAC name of 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one (CID 15618513) is 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one.
What is the SMILES notation for 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one?
The canonical SMILES for 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one is CC1OC2=C(C(=O)CCC2)C1(C)C.
What is the InChIKey of 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one?
The InChIKey is WRFNHMYKSIHBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-7-11(2,3)10-8(12)5-4-6-9(10)13-7/h7H,4-6H2,1-3H3.
What are the key properties of 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one?
2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one has a molecular weight of 180.25 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-4-one is sourced from PubChem (CID 15618513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).