C14H22O — CID 151112972
1,2,2,3,3-pentamethyl-1,5,6,7-tetrahydroinden-4-one (PubChem CID 151112972) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 1,2,2,3,3-pentamethyl-1,5,6,7-tetrahydroinden-4-one.
| Compound Name | 1,2,2,3,3-pentamethyl-1,5,6,7-tetrahydroinden-4-one |
|---|---|
| PubChem CID | 151112972 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1,2,2,3,3-pentamethyl-1,5,6,7-tetrahydroinden-4-one |
| SMILES | CC1C2=C(C(=O)CCC2)C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H22O/c1-9-10-7-6-8-11(15)12(10)14(4,5)13(9,2)3/h9H,6-8H2,1-5H3 |
| InChIKey | MQNTUICLWSVQQY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |