C16H24O — CID 100994191
(2S,4aR,10aR)-2,10a-dimethyl-1,2,3,4,4a,5,6,7,8,9-decahydrobenzo[a]azulen-10-one (PubChem CID 100994191) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (2S,4aR,10aR)-2,10a-dimethyl-1,2,3,4,4a,5,6,7,8,9-decahydrobenzo[a]azulen-10-one.
| Compound Name | (2S,4aR,10aR)-2,10a-dimethyl-1,2,3,4,4a,5,6,7,8,9-decahydrobenzo[a]azulen-10-one |
|---|---|
| PubChem CID | 100994191 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (2S,4aR,10aR)-2,10a-dimethyl-1,2,3,4,4a,5,6,7,8,9-decahydrobenzo[a]azulen-10-one |
| SMILES | C[C@H]1CC[C@@H]2C3=C(CCCCC3)C(=O)[C@]2(C)C1 |
| InChI | InChI=1S/C16H24O/c1-11-8-9-14-12-6-4-3-5-7-13(12)15(17)16(14,2)10-11/h11,14H,3-10H2,1-2H3/t11-,14+,16+/m0/s1 |
| InChIKey | GNCCYERRYUHVPX-SGIREYDYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |