C12H18O — CID 11041286
(3aR,6S,7aR)-2,6,7a-trimethyl-4,5,6,7-tetrahydro-3aH-inden-1-one (PubChem CID 11041286) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (3aR,6S,7aR)-2,6,7a-trimethyl-4,5,6,7-tetrahydro-3aH-inden-1-one.
| Compound Name | (3aR,6S,7aR)-2,6,7a-trimethyl-4,5,6,7-tetrahydro-3aH-inden-1-one |
|---|---|
| PubChem CID | 11041286 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3aR,6S,7aR)-2,6,7a-trimethyl-4,5,6,7-tetrahydro-3aH-inden-1-one |
| SMILES | CC1=C[C@H]2CC[C@H](C)C[C@@]2(C)C1=O |
| InChI | InChI=1S/C12H18O/c1-8-4-5-10-6-9(2)11(13)12(10,3)7-8/h6,8,10H,4-5,7H2,1-3H3/t8-,10+,12+/m0/s1 |
| InChIKey | XVOGEMNKFNCWTN-MKPLZMMCSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |