C24H36O — CID 58835418
(1S,2S,6S,10S,11R,13R,14R,15R)-1,4,6,8,12,12,13,14,15-nonamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one (PubChem CID 58835418) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is (1S,2S,6S,10S,11R,13R,14R,15R)-1,4,6,8,12,12,13,14,15-nonamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one.
| Compound Name | (1S,2S,6S,10S,11R,13R,14R,15R)-1,4,6,8,12,12,13,14,15-nonamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
|---|---|
| PubChem CID | 58835418 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (1S,2S,6S,10S,11R,13R,14R,15R)-1,4,6,8,12,12,13,14,15-nonamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one |
| SMILES | CC1=C[C@H]2[C@@H]3C(C)(C)[C@]3(C)[C@H](C)[C@@H](C)[C@]2(C)[C@@H]2C=C(C)C(=O)[C@@]2(C)C1 |
| InChI | InChI=1S/C24H36O/c1-13-10-17-19-21(5,6)24(19,9)16(4)15(3)23(17,8)18-11-14(2)20(25)22(18,7)12-13/h10-11,15-19H,12H2,1-9H3/t15-,16-,17+,18-,19-,22+,23+,24-/m1/s1 |
| InChIKey | KYYJYEMUFSUGJL-HDJPFBAJSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|