C22H22O2 — CID 10925196
(11S,14S)-16,19-dimethylpentacyclo[9.6.3.01,10.03,8.010,14]icosa-3,5,7,15,19-pentaene-2,9-dione (PubChem CID 10925196) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (11S,14S)-16,19-dimethylpentacyclo[9.6.3.01,10.03,8.010,14]icosa-3,5,7,15,19-pentaene-2,9-dione.
| Compound Name | (11S,14S)-16,19-dimethylpentacyclo[9.6.3.01,10.03,8.010,14]icosa-3,5,7,15,19-pentaene-2,9-dione |
|---|---|
| PubChem CID | 10925196 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (11S,14S)-16,19-dimethylpentacyclo[9.6.3.01,10.03,8.010,14]icosa-3,5,7,15,19-pentaene-2,9-dione |
| SMILES | CC1=C[C@@H]2CC[C@H]3C=C(C)CC4(C1)C(=O)c1ccccc1C(=O)C234 |
| InChI | InChI=1S/C22H22O2/c1-13-9-15-7-8-16-10-14(2)12-21(11-13)19(23)17-5-3-4-6-18(17)20(24)22(15,16)21/h3-6,9-10,15-16H,7-8,11-12H2,1-2H3/t15-,16-,21?,22?/m0/s1 |
| InChIKey | JAKFPBUMESVYPM-TUKZGULFSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|