C14H12O3 — CID 10059650
2-cyclopent-2-en-1-yl-2-hydroxyindene-1,3-dione (PubChem CID 10059650) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-2-hydroxyindene-1,3-dione.
| Compound Name | 2-cyclopent-2-en-1-yl-2-hydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 10059650 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-2-hydroxyindene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1(O)C1C=CCC1 |
| InChI | InChI=1S/C14H12O3/c15-12-10-7-3-4-8-11(10)13(16)14(12,17)9-5-1-2-6-9/h1,3-5,7-9,17H,2,6H2 |
| InChIKey | HRHWHALIKLKNSC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|