C20H16O — CID 134919081
(1S,6R)-spiro[bicyclo[4.2.0]oct-2-ene-8,9'-fluorene]-7-one (PubChem CID 134919081) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is (1S,6R)-spiro[bicyclo[4.2.0]oct-2-ene-8,9'-fluorene]-7-one.
| Compound Name | (1S,6R)-spiro[bicyclo[4.2.0]oct-2-ene-8,9'-fluorene]-7-one |
|---|---|
| PubChem CID | 134919081 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (1S,6R)-spiro[bicyclo[4.2.0]oct-2-ene-8,9'-fluorene]-7-one |
| SMILES | O=C1[C@@H]2CCC=C[C@@H]2C12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C20H16O/c21-19-15-9-3-6-12-18(15)20(19)16-10-4-1-7-13(16)14-8-2-5-11-17(14)20/h1-2,4-8,10-12,15,18H,3,9H2/t15-,18+/m1/s1 |
| InChIKey | XYWVUKZDIYFLNW-QAPCUYQASA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|