C13H12OS — CID 126606929
(9aR)-1,2,4a,9a-tetrahydrothioxanthen-9-one (PubChem CID 126606929) has the molecular formula C13H12OS and a molecular weight of 216.31 g/mol. Its IUPAC name is (9aR)-1,2,4a,9a-tetrahydrothioxanthen-9-one.
| Compound Name | (9aR)-1,2,4a,9a-tetrahydrothioxanthen-9-one |
|---|---|
| PubChem CID | 126606929 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (9aR)-1,2,4a,9a-tetrahydrothioxanthen-9-one |
| SMILES | O=C1c2ccccc2SC2C=CCC[C@H]12 |
| InChI | InChI=1S/C13H12OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3-5,7-8,10,12H,2,6H2/t10-,12?/m0/s1 |
| InChIKey | JTANDECHLFDTJL-NUHJPDEHSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|