C14H14O3 — CID 134876374
(4aS,9aS)-9a-hydroxy-3,4,4a,10-tetrahydro-2H-anthracene-1,9-dione (PubChem CID 134876374) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (4aS,9aS)-9a-hydroxy-3,4,4a,10-tetrahydro-2H-anthracene-1,9-dione.
| Compound Name | (4aS,9aS)-9a-hydroxy-3,4,4a,10-tetrahydro-2H-anthracene-1,9-dione |
|---|---|
| PubChem CID | 134876374 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (4aS,9aS)-9a-hydroxy-3,4,4a,10-tetrahydro-2H-anthracene-1,9-dione |
| SMILES | O=C1CCC[C@H]2Cc3ccccc3C(=O)[C@@]12O |
| InChI | InChI=1S/C14H14O3/c15-12-7-3-5-10-8-9-4-1-2-6-11(9)13(16)14(10,12)17/h1-2,4,6,10,17H,3,5,7-8H2/t10-,14-/m0/s1 |
| InChIKey | TWLKZXODZXSHJN-HZMBPMFUSA-N |
| XLogP | 1.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|