C17H26 — CID 162287885
1-methyl-4-[(1,2,5-trimethylcyclohexyl)methyl]benzene (PubChem CID 162287885) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-methyl-4-[(1,2,5-trimethylcyclohexyl)methyl]benzene.
| Compound Name | 1-methyl-4-[(1,2,5-trimethylcyclohexyl)methyl]benzene |
|---|---|
| PubChem CID | 162287885 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-methyl-4-[(1,2,5-trimethylcyclohexyl)methyl]benzene |
| SMILES | Cc1ccc(CC2(C)CC(C)CCC2C)cc1 |
| InChI | InChI=1S/C17H26/c1-13-6-9-16(10-7-13)12-17(4)11-14(2)5-8-15(17)3/h6-7,9-10,14-15H,5,8,11-12H2,1-4H3 |
| InChIKey | BEDCXAINZYXOKD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |