About 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one
9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one (PubChem CID 132602395) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one.
Analyze 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one?
The IUPAC name of 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one (CID 132602395) is 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one.
What is the SMILES notation for 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one?
The canonical SMILES for 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one is CC12CCCC(O1)C1=C(CCCC1=O)O2.
What is the InChIKey of 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one?
The InChIKey is VAHHNNXVJGVAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-12-7-3-6-10(15-12)11-8(13)4-2-5-9(11)14-12/h10H,2-7H2,1H3.
What are the key properties of 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one?
9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one has a molecular weight of 208.26 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-8,13-dioxatricyclo[7.3.1.02,7]tridec-2(7)-en-3-one is sourced from PubChem (CID 132602395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).