C16H20O3 — CID 10682779
9-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 10682779) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 9-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 10682779 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 9-propan-2-yl-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CC(C)C1C2=C(CCCC2=O)OC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C16H20O3/c1-9(2)14-15-10(17)5-3-7-12(15)19-13-8-4-6-11(18)16(13)14/h9,14H,3-8H2,1-2H3 |
| InChIKey | XAMUBPFOZPEOOB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |