C10H12O3 — CID 163140528
4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-one (PubChem CID 163140528) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-one.
| Compound Name | 4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 163140528 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-one |
| SMILES | CC1=C(O)C2=C(CCCC2=O)OC1 |
| InChI | InChI=1S/C10H12O3/c1-6-5-13-8-4-2-3-7(11)9(8)10(6)12/h12H,2-5H2,1H3 |
| InChIKey | JPLDAQIJLFVYDE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |