C12H18O3 — CID 129386913
(2R,4R)-2-ethoxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 129386913) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R,4R)-2-ethoxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | (2R,4R)-2-ethoxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 129386913 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R,4R)-2-ethoxy-4-methyl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCO[C@H]1C[C@@H](C)C2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-3-14-11-7-8(2)12-9(13)5-4-6-10(12)15-11/h8,11H,3-7H2,1-2H3/t8-,11-/m1/s1 |
| InChIKey | JQSVMOMBBHQBSL-LDYMZIIASA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |