C14H20O4 — CID 102160148
[(2R,4S)-4,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydro-2H-chromen-2-yl] acetate (PubChem CID 102160148) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(2R,4S)-4,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydro-2H-chromen-2-yl] acetate.
| Compound Name | [(2R,4S)-4,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydro-2H-chromen-2-yl] acetate |
|---|---|
| PubChem CID | 102160148 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(2R,4S)-4,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydro-2H-chromen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](C)C2=C(CC(C)(C)CC2=O)O1 |
| InChI | InChI=1S/C14H20O4/c1-8-5-12(17-9(2)15)18-11-7-14(3,4)6-10(16)13(8)11/h8,12H,5-7H2,1-4H3/t8-,12-/m0/s1 |
| InChIKey | YYVCFAPXQNWZOU-UFBFGSQYSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |