C16H22O4 — CID 637046
[(4R,7S,8S,10R)-4,6,6,10-tetramethyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(11)-en-8-yl] acetate (PubChem CID 637046) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(4R,7S,8S,10R)-4,6,6,10-tetramethyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(11)-en-8-yl] acetate.
| Compound Name | [(4R,7S,8S,10R)-4,6,6,10-tetramethyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(11)-en-8-yl] acetate |
|---|---|
| PubChem CID | 637046 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(4R,7S,8S,10R)-4,6,6,10-tetramethyl-2-oxo-3-oxatricyclo[5.3.1.04,11]undec-1(11)-en-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)C2=C3[C@@H]1C(C)(C)C[C@@]3(C)OC2=O |
| InChI | InChI=1S/C16H22O4/c1-8-6-10(19-9(2)17)12-13-11(8)14(18)20-16(13,5)7-15(12,3)4/h8,10,12H,6-7H2,1-5H3/t8-,10+,12-,16-/m1/s1 |
| InChIKey | OMZUEHMZFLBHNI-PCKWUFTNSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |