C12H16O4 — CID 10082347
2-methoxy-2,3,4,4a,6,7,8,9a-octahydropyrano[2,3-b][1]benzofuran-5-one (PubChem CID 10082347) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-methoxy-2,3,4,4a,6,7,8,9a-octahydropyrano[2,3-b][1]benzofuran-5-one.
| Compound Name | 2-methoxy-2,3,4,4a,6,7,8,9a-octahydropyrano[2,3-b][1]benzofuran-5-one |
|---|---|
| PubChem CID | 10082347 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-methoxy-2,3,4,4a,6,7,8,9a-octahydropyrano[2,3-b][1]benzofuran-5-one |
| SMILES | COC1CCC2C3=C(CCCC3=O)OC2O1 |
| InChI | InChI=1S/C12H16O4/c1-14-10-6-5-7-11-8(13)3-2-4-9(11)15-12(7)16-10/h7,10,12H,2-6H2,1H3 |
| InChIKey | UMUJRPVTOKUGFC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |