C19H20O6 — CID 72736690
ethyl (1R,9R,17S)-5-methoxy-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate (PubChem CID 72736690) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is ethyl (1R,9R,17S)-5-methoxy-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate.
| Compound Name | ethyl (1R,9R,17S)-5-methoxy-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate |
|---|---|
| PubChem CID | 72736690 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | ethyl (1R,9R,17S)-5-methoxy-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2OC3=C(C(=O)CCC3)[C@H]1c1ccc(OC)cc1O2 |
| InChI | InChI=1S/C19H20O6/c1-3-23-18(21)17-15-11-8-7-10(22-2)9-14(11)25-19(17)24-13-6-4-5-12(20)16(13)15/h7-9,15,17,19H,3-6H2,1-2H3/t15-,17-,19-/m1/s1 |
| InChIKey | ZTVGHEBHMZICPJ-SZVBFZGTSA-N |
| XLogP | 2.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |