C17H21NO6 — CID 134786758
diethyl (3R,3aS,8bS)-6-methoxy-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1,3-dicarboxylate (PubChem CID 134786758) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is diethyl (3R,3aS,8bS)-6-methoxy-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1,3-dicarboxylate.
| Compound Name | diethyl (3R,3aS,8bS)-6-methoxy-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134786758 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | diethyl (3R,3aS,8bS)-6-methoxy-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)OCC)[C@H]2c3ccc(OC)cc3O[C@@H]12 |
| InChI | InChI=1S/C17H21NO6/c1-4-22-16(19)12-9-18(17(20)23-5-2)14-11-7-6-10(21-3)8-13(11)24-15(12)14/h6-8,12,14-15H,4-5,9H2,1-3H3/t12-,14+,15+/m1/s1 |
| InChIKey | YWAPAZQGBLTTKY-SNPRPXQTSA-N |
| XLogP | 2.15 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |