C21H21FN2O4 — CID 134787050
ethyl (3R,3aS,8bS)-1-(benzylcarbamoyl)-5-fluoro-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate (PubChem CID 134787050) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is ethyl (3R,3aS,8bS)-1-(benzylcarbamoyl)-5-fluoro-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate.
| Compound Name | ethyl (3R,3aS,8bS)-1-(benzylcarbamoyl)-5-fluoro-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134787050 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | ethyl (3R,3aS,8bS)-1-(benzylcarbamoyl)-5-fluoro-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)NCc2ccccc2)[C@H]2c3cccc(F)c3O[C@@H]12 |
| InChI | InChI=1S/C21H21FN2O4/c1-2-27-20(25)15-12-24(21(26)23-11-13-7-4-3-5-8-13)17-14-9-6-10-16(22)18(14)28-19(15)17/h3-10,15,17,19H,2,11-12H2,1H3,(H,23,26)/t15-,17+,19+/m1/s1 |
| InChIKey | BPCYAROAGZMNTL-AYBZRNKSSA-N |
| XLogP | 3.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |