C21H20FNO4 — CID 134786991
ethyl (3R,3aS,8bS)-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate (PubChem CID 134786991) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is ethyl (3R,3aS,8bS)-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate.
| Compound Name | ethyl (3R,3aS,8bS)-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134786991 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | ethyl (3R,3aS,8bS)-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)Cc2ccc(F)cc2)[C@H]2c3ccccc3O[C@@H]12 |
| InChI | InChI=1S/C21H20FNO4/c1-2-26-21(25)16-12-23(18(24)11-13-7-9-14(22)10-8-13)19-15-5-3-4-6-17(15)27-20(16)19/h3-10,16,19-20H,2,11-12H2,1H3/t16-,19+,20+/m1/s1 |
| InChIKey | XJLWQTUDMDBOCW-UXPWSPDFSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |