C19H18ClNO3 — CID 134786915
1-[(3S,3aS,8bS)-7-chloro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-phenylethanone (PubChem CID 134786915) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 1-[(3S,3aS,8bS)-7-chloro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-phenylethanone.
| Compound Name | 1-[(3S,3aS,8bS)-7-chloro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 134786915 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-[(3S,3aS,8bS)-7-chloro-3-(hydroxymethyl)-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrol-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1C[C@@H](CO)[C@@H]2Oc3ccc(Cl)cc3[C@@H]21 |
| InChI | InChI=1S/C19H18ClNO3/c20-14-6-7-16-15(9-14)18-19(24-16)13(11-22)10-21(18)17(23)8-12-4-2-1-3-5-12/h1-7,9,13,18-19,22H,8,10-11H2/t13-,18-,19-/m0/s1 |
| InChIKey | UEYZFKSZZMQSHA-AGRHKRQWSA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |