C14H16N2O4 — CID 155901080
ethyl (3R,3aS,8bS)-3-carbamoyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate (PubChem CID 155901080) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is ethyl (3R,3aS,8bS)-3-carbamoyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate.
| Compound Name | ethyl (3R,3aS,8bS)-3-carbamoyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 155901080 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | ethyl (3R,3aS,8bS)-3-carbamoyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@@H](C(N)=O)[C@@H]2Oc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C14H16N2O4/c1-2-19-14(18)16-7-9(13(15)17)12-11(16)8-5-3-4-6-10(8)20-12/h3-6,9,11-12H,2,7H2,1H3,(H2,15,17)/t9-,11+,12+/m1/s1 |
| InChIKey | JNVVZYKPRHRYDQ-USWWRNFRSA-N |
| XLogP | 1.06 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |