C17H22N2O4 — CID 134786211
butyl (3R,3aS,8bS)-3-carbamoyl-5-methyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate (PubChem CID 134786211) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is butyl (3R,3aS,8bS)-3-carbamoyl-5-methyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate.
| Compound Name | butyl (3R,3aS,8bS)-3-carbamoyl-5-methyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 134786211 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | butyl (3R,3aS,8bS)-3-carbamoyl-5-methyl-2,3,3a,8b-tetrahydro-[1]benzofuro[3,2-b]pyrrole-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@@H](C(N)=O)[C@@H]2Oc3c(C)cccc3[C@@H]21 |
| InChI | InChI=1S/C17H22N2O4/c1-3-4-8-22-17(21)19-9-12(16(18)20)15-13(19)11-7-5-6-10(2)14(11)23-15/h5-7,12-13,15H,3-4,8-9H2,1-2H3,(H2,18,20)/t12-,13+,15+/m1/s1 |
| InChIKey | CZHTXZCROVLHHD-IPYPFGDCSA-N |
| XLogP | 2.15 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|