C12H13ClO3 — CID 141272617
ethyl 2-chloro-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 141272617) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is ethyl 2-chloro-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | ethyl 2-chloro-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 141272617 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | ethyl 2-chloro-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CCOC(=O)C1CC(Cl)Oc2ccccc21 |
| InChI | InChI=1S/C12H13ClO3/c1-2-15-12(14)9-7-11(13)16-10-6-4-3-5-8(9)10/h3-6,9,11H,2,7H2,1H3 |
| InChIKey | OZDFYFVFMMLGPA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|