C13H16O4 — CID 86334083
ethyl (3S)-7-methoxy-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 86334083) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl (3S)-7-methoxy-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | ethyl (3S)-7-methoxy-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 86334083 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethyl (3S)-7-methoxy-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1COc2cc(OC)ccc2C1 |
| InChI | InChI=1S/C13H16O4/c1-3-16-13(14)10-6-9-4-5-11(15-2)7-12(9)17-8-10/h4-5,7,10H,3,6,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | WYDXWFSEPMSSNJ-JTQLQIEISA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |