C20H22O6 — CID 101457418
methyl (1S,9S)-5-methoxy-13,13-dimethyl-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate (PubChem CID 101457418) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (1S,9S)-5-methoxy-13,13-dimethyl-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate.
| Compound Name | methyl (1S,9S)-5-methoxy-13,13-dimethyl-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate |
|---|---|
| PubChem CID | 101457418 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl (1S,9S)-5-methoxy-13,13-dimethyl-15-oxo-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16)-tetraene-17-carboxylate |
| SMILES | COC(=O)C1[C@H]2OC3=C(C(=O)CC(C)(C)C3)[C@@H]1c1ccc(OC)cc1O2 |
| InChI | InChI=1S/C20H22O6/c1-20(2)8-12(21)16-14(9-20)26-19-17(18(22)24-4)15(16)11-6-5-10(23-3)7-13(11)25-19/h5-7,15,17,19H,8-9H2,1-4H3/t15-,17?,19+/m0/s1 |
| InChIKey | GYTHCHCSCBNZOL-APROBQCTSA-N |
| XLogP | 2.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |