C25H25N3O5 — CID 155927611
2-(4-azidobenzoyl)-3-(2,5-dimethoxyphenyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one (PubChem CID 155927611) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-(4-azidobenzoyl)-3-(2,5-dimethoxyphenyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one.
| Compound Name | 2-(4-azidobenzoyl)-3-(2,5-dimethoxyphenyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 155927611 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-(4-azidobenzoyl)-3-(2,5-dimethoxyphenyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one |
| SMILES | COc1ccc(OC)c(C2C3=C(CC(C)(C)CC3=O)OC2C(=O)c2ccc(N=[N+]=[N-])cc2)c1 |
| InChI | InChI=1S/C25H25N3O5/c1-25(2)12-18(29)22-20(13-25)33-24(23(30)14-5-7-15(8-6-14)27-28-26)21(22)17-11-16(31-3)9-10-19(17)32-4/h5-11,21,24H,12-13H2,1-4H3 |
| InChIKey | KGULFHZJTNZRMM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|