C33H36O7 — CID 4502336
[2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 4-methoxybenzoate (PubChem CID 4502336) has the molecular formula C33H36O7 and a molecular weight of 544.64 g/mol. Its IUPAC name is [2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 4-methoxybenzoate.
| Compound Name | [2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4502336 |
| Molecular Formula | C33H36O7 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [2-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)ccc1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H36O7/c1-7-38-25-14-20(10-13-24(25)40-31(36)19-8-11-21(37-6)12-9-19)28-29-22(34)15-32(2,3)17-26(29)39-27-18-33(4,5)16-23(35)30(27)28/h8-14,28H,7,15-18H2,1-6H3 |
| InChIKey | NIRMFCGBQIAWRA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|