C18H26O3 — CID 163232776
5-ethoxy-9-methylidene-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one;prop-1-ene (PubChem CID 163232776) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 5-ethoxy-9-methylidene-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one;prop-1-ene.
| Compound Name | 5-ethoxy-9-methylidene-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one;prop-1-ene |
|---|---|
| PubChem CID | 163232776 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 5-ethoxy-9-methylidene-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one;prop-1-ene |
| SMILES | C=C1CCCC2C(OCC)OC3=C(C(=O)CC3)C12.C=CC |
| InChI | InChI=1S/C15H20O3.C3H6/c1-3-17-15-10-6-4-5-9(2)13(10)14-11(16)7-8-12(14)18-15;1-3-2/h10,13,15H,2-8H2,1H3;3H,1H2,2H3 |
| InChIKey | GBJUTLUEMAHDLS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|