C8H12O3 — CID 143981955
(5S)-4-ethoxy-5-methyl-3-methylideneoxolan-2-one (PubChem CID 143981955) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (5S)-4-ethoxy-5-methyl-3-methylideneoxolan-2-one.
| Compound Name | (5S)-4-ethoxy-5-methyl-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 143981955 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (5S)-4-ethoxy-5-methyl-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](C)C1OCC |
| InChI | InChI=1S/C8H12O3/c1-4-10-7-5(2)8(9)11-6(7)3/h6-7H,2,4H2,1,3H3/t6-,7?/m0/s1 |
| InChIKey | PLPAGRJLNXRCAC-PKPIPKONSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|