C6H10O3S — CID 124629986
(2S,4S)-2-ethoxy-4-methyl-1,3-oxathiolan-5-one (PubChem CID 124629986) has the molecular formula C6H10O3S and a molecular weight of 162.21 g/mol. Its IUPAC name is (2S,4S)-2-ethoxy-4-methyl-1,3-oxathiolan-5-one.
| Compound Name | (2S,4S)-2-ethoxy-4-methyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 124629986 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (2S,4S)-2-ethoxy-4-methyl-1,3-oxathiolan-5-one |
| SMILES | CCO[C@H]1OC(=O)[C@H](C)S1 |
| InChI | InChI=1S/C6H10O3S/c1-3-8-6-9-5(7)4(2)10-6/h4,6H,3H2,1-2H3/t4-,6-/m0/s1 |
| InChIKey | QJUIPGBPPKNOID-NJGYIYPDSA-N |
| XLogP | 0.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |