C9H19N2O5P — CID 10683153
(4R,5S)-3-amino-4-(diethoxyphosphorylmethyl)-5-methyl-1,3-oxazolidin-2-one (PubChem CID 10683153) has the molecular formula C9H19N2O5P and a molecular weight of 266.23 g/mol. Its IUPAC name is (4R,5S)-3-amino-4-(diethoxyphosphorylmethyl)-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-amino-4-(diethoxyphosphorylmethyl)-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10683153 |
| Molecular Formula | C9H19N2O5P |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (4R,5S)-3-amino-4-(diethoxyphosphorylmethyl)-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CCOP(=O)(C[C@H]1[C@H](C)OC(=O)N1N)OCC |
| InChI | InChI=1S/C9H19N2O5P/c1-4-14-17(13,15-5-2)6-8-7(3)16-9(12)11(8)10/h7-8H,4-6,10H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | CTBZYYOSMJIOMT-YUMQZZPRSA-N |
| XLogP | 1.34 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|