C15H28NO7P — CID 131716302
diethyl (2R,3R)-3-(diethoxyphosphorylmethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 131716302) has the molecular formula C15H28NO7P and a molecular weight of 365.36 g/mol. Its IUPAC name is diethyl (2R,3R)-3-(diethoxyphosphorylmethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | diethyl (2R,3R)-3-(diethoxyphosphorylmethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 131716302 |
| Molecular Formula | C15H28NO7P |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | diethyl (2R,3R)-3-(diethoxyphosphorylmethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](CP(=O)(OCC)OCC)CCN1C(=O)OCC |
| InChI | InChI=1S/C15H28NO7P/c1-5-20-14(17)13-12(9-10-16(13)15(18)21-6-2)11-24(19,22-7-3)23-8-4/h12-13H,5-11H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | BDWMOVAHIMVQAC-QWHCGFSZSA-N |
| XLogP | 2.66 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|