C10H14O2 — CID 117071156
(1S,6R)-7-methoxy-8-methylidenebicyclo[4.2.0]octan-2-one (PubChem CID 117071156) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S,6R)-7-methoxy-8-methylidenebicyclo[4.2.0]octan-2-one.
| Compound Name | (1S,6R)-7-methoxy-8-methylidenebicyclo[4.2.0]octan-2-one |
|---|---|
| PubChem CID | 117071156 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1S,6R)-7-methoxy-8-methylidenebicyclo[4.2.0]octan-2-one |
| SMILES | C=C1C(OC)[C@@H]2CCCC(=O)[C@H]12 |
| InChI | InChI=1S/C10H14O2/c1-6-9-7(10(6)12-2)4-3-5-8(9)11/h7,9-10H,1,3-5H2,2H3/t7-,9-,10?/m1/s1 |
| InChIKey | BPXQGLQCOIEVBN-QVSNTAFXSA-N |
| XLogP | 1.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|