C13H15N3O2 — CID 70596915
5-(4-pyrrolidin-1-ylphenyl)imidazolidine-2,4-dione (PubChem CID 70596915) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(4-pyrrolidin-1-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-(4-pyrrolidin-1-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70596915 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-(4-pyrrolidin-1-ylphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccc(N3CCCC3)cc2)N1 |
| InChI | InChI=1S/C13H15N3O2/c17-12-11(14-13(18)15-12)9-3-5-10(6-4-9)16-7-1-2-8-16/h3-6,11H,1-2,7-8H2,(H2,14,15,17,18) |
| InChIKey | OKNPTSQFUGQWQD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|