C13H16N4O3 — CID 141182507
2-(dimethylamino)-N-[4-[(4R)-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide (PubChem CID 141182507) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-[(4R)-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[4-[(4R)-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 141182507 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(dimethylamino)-N-[4-[(4R)-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide |
| SMILES | CN(C)CC(=O)Nc1ccc([C@H]2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C13H16N4O3/c1-17(2)7-10(18)14-9-5-3-8(4-6-9)11-12(19)16-13(20)15-11/h3-6,11H,7H2,1-2H3,(H,14,18)(H2,15,16,19,20)/t11-/m1/s1 |
| InChIKey | HLBQKXFROVVNIZ-LLVKDONJSA-N |
| XLogP | 0.07 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|