C16H10F3N3O3 — CID 110715272
N-[4-(2,5-dioxoimidazolidin-4-yl)phenyl]-2,3,4-trifluorobenzamide (PubChem CID 110715272) has the molecular formula C16H10F3N3O3 and a molecular weight of 349.27 g/mol. Its IUPAC name is N-[4-(2,5-dioxoimidazolidin-4-yl)phenyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[4-(2,5-dioxoimidazolidin-4-yl)phenyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110715272 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[4-(2,5-dioxoimidazolidin-4-yl)phenyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C1NC(=O)C(c2ccc(NC(=O)c3ccc(F)c(F)c3F)cc2)N1 |
| InChI | InChI=1S/C16H10F3N3O3/c17-10-6-5-9(11(18)12(10)19)14(23)20-8-3-1-7(2-4-8)13-15(24)22-16(25)21-13/h1-6,13H,(H,20,23)(H2,21,22,24,25) |
| InChIKey | BNKILGTZTMLTAO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|