C21H16F3N3O2 — CID 112988382
N-[4-(4-acetamidoanilino)phenyl]-2,3,4-trifluorobenzamide (PubChem CID 112988382) has the molecular formula C21H16F3N3O2 and a molecular weight of 399.37 g/mol. Its IUPAC name is N-[4-(4-acetamidoanilino)phenyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[4-(4-acetamidoanilino)phenyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 112988382 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[4-(4-acetamidoanilino)phenyl]-2,3,4-trifluorobenzamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccc(NC(=O)c3ccc(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C21H16F3N3O2/c1-12(28)25-13-2-4-14(5-3-13)26-15-6-8-16(9-7-15)27-21(29)17-10-11-18(22)20(24)19(17)23/h2-11,26H,1H3,(H,25,28)(H,27,29) |
| InChIKey | IHILDMDVXNSAPG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|