C16H11F2N3O3 — CID 110715466
N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]-3,4-difluorobenzamide (PubChem CID 110715466) has the molecular formula C16H11F2N3O3 and a molecular weight of 331.28 g/mol. Its IUPAC name is N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110715466 |
| Molecular Formula | C16H11F2N3O3 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]-3,4-difluorobenzamide |
| SMILES | O=C1NC(=O)C(c2cccc(NC(=O)c3ccc(F)c(F)c3)c2)N1 |
| InChI | InChI=1S/C16H11F2N3O3/c17-11-5-4-9(7-12(11)18)14(22)19-10-3-1-2-8(6-10)13-15(23)21-16(24)20-13/h1-7,13H,(H,19,22)(H2,20,21,23,24) |
| InChIKey | OGVYBKAQLNGBRK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|