C17H16N4O3 — CID 110747610
1-benzyl-3-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]urea (PubChem CID 110747610) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-benzyl-3-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]urea.
| Compound Name | 1-benzyl-3-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 110747610 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-benzyl-3-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1cccc(C2NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C17H16N4O3/c22-15-14(20-17(24)21-15)12-7-4-8-13(9-12)19-16(23)18-10-11-5-2-1-3-6-11/h1-9,14H,10H2,(H2,18,19,23)(H2,20,21,22,24) |
| InChIKey | PYNOGFGKUSFRHE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|